Equilibrium

Class 11 · Chemistry · 71 Questions

6.5intermediate🔧 Apply2 marksNumerical

Find out the value of KcK_c for each of the following equilibria from the value of KpK_p: (i) 2NOCl(g)2NO(g)+Cl2(g)2NOCl(g) \rightleftharpoons 2NO(g) + Cl_2(g); Kp=1.8×102K_p = 1.8 \times 10^{-2} at 500 K (ii) CaCO3(s)CaO(s)+CO2(g)CaCO_3(s) \rightleftharpoons CaO(s) + CO_2(g); Kp=167K_p = 167 at 1073 K

6.8advanced🔧 Apply3 marksNumerical

Reaction between N2N_2 and O2O_2 takes place as follows: 2N2(g)+O2(g)2N2O(g)2N_2 (g) + O_2 (g) \rightleftharpoons 2N_2O (g) If a mixture of 0.482 mol N2N_2 and 0.933 mol of O2O_2 is placed in a 10 L reaction vessel and allowed to form N2ON_2O at a temperature for which Kc=2.0×1037K_c = 2.0 \times 10^{-37}, determine the composition of equilibrium mixture.

6.11intermediate🔧 Apply3 marksNumerical

A sample of HI(g) is placed in flask at a pressure of 0.2 atm. At equilibrium the partial pressure of HI(g) is 0.04 atm. What is KpK_p for the given equilibrium? 2HI(g)H2(g)+I2(g)2HI (g) \rightleftharpoons H_2 (g) + I_2 (g)

6.13intermediate🔧 Apply2 marksShort Answer

The equilibrium constant expression for a gas reaction is, Kc=[NH3]4[O2]5[NO]4[H2O]6K_c = \frac{[NH_3]^4 [O_2]^5}{[NO]^4 [H_2O]^6} Write the balanced chemical equation corresponding to this expression.

6.15intermediate🔧 Apply3 marksNumerical

At 700 K, equilibrium constant for the reaction: H2(g)+I2(g)2HI(g)H_2 (g) + I_2 (g) \rightleftharpoons 2HI (g) is 54.8. If 0.5 mol L1^{-1} of HI(g) is present at equilibrium at 700 K, what are the concentration of H2(g)H_2(g) and I2(g)I_2(g) assuming that we initially started with HI(g) and allowed it to reach equilibrium at 700 K?

6.18advanced🔧 Apply5 marksNumerical

Ethyl acetate is formed by the reaction between ethanol and acetic acid and the equilibrium is represented as: CH3COOH(l)+C2H5OH(l)CH3COOC2H5(l)+H2O(l)CH_3COOH (l) + C_2H_5OH (l) \rightleftharpoons CH_3COOC_2H_5(l) + H_2O (l) (i) Write the concentration ratio (reaction quotient), QcQ_c, for this reaction (note: water is not in excess and is not a solvent in this reaction) (ii) At 293 K, if one starts with 1.00 mol of acetic acid and 0.18 mol of ethanol, there is 0.171 mol of ethyl acetate in the final equilibrium mixture. Calculate the equilibrium constant. (iii) Starting with 0.5 mol of ethanol and 1.0 mol of acetic acid and maintaining it at 293 K, 0.214 mol of ethyl acetate is found after sometime. Has equilibrium been reached?

6.20intermediate🔧 Apply3 marksNumerical

One of the reaction that takes place in producing steel from iron ore is the reduction of iron(II) oxide by carbon monoxide to give iron metal and CO2_2. FeO(s)+CO(g)Fe(s)+CO2(g);Kp=0.265 atm at 1050 KFeO (s) + CO (g) \rightleftharpoons Fe (s) + CO_2(g); \quad K_p = 0.265 \text{ atm at 1050 K} What are the equilibrium partial pressures of CO and CO2_2 at 1050 K if the initial partial pressures are: pCO=1.4p_{CO} = 1.4 atm and pCO2=0.80p_{CO_2} = 0.80 atm?

6.22intermediate🔧 Apply3 marksNumerical

Bromine monochloride, BrCl decomposes into bromine and chlorine and reaches the equilibrium: 2BrCl(g)Br2(g)+Cl2(g)2BrCl (g) \rightleftharpoons Br_2(g) + Cl_2(g) for which Kc=32K_c = 32 at 500 K. If initially pure BrCl is present at a concentration of 3.3×1033.3 \times 10^{-3} mol L1^{-1}, what is its molar concentration in the mixture at equilibrium?

6.23advanced🔧 Apply3 marksNumerical

At 1127 K and 1 atm pressure, a gaseous mixture of CO and CO2_2 in equilibrium with soild carbon has 90.55% CO by mass C(s)+CO2(g)2CO(g)C (s) + CO_2(g) \rightleftharpoons 2CO (g) Calculate KcK_c for this reaction at the above temperature.

6.24intermediate🔧 Apply3 marksNumerical

Calculate a) ΔG\Delta G^\circ and b) the equilibrium constant for the formation of NO2_2 from NO and O2_2 at 298K NO(g)+12O2(g)NO2(g)NO (g) + \frac{1}{2} O_2 (g) \rightleftharpoons NO_2 (g) where ΔG(NO2)=52.0 kJ/mol\Delta G^\circ (NO_2) = 52.0 \text{ kJ/mol} ΔG(NO)=87.0 kJ/mol\Delta G^\circ (NO) = 87.0 \text{ kJ/mol} ΔG(O2)=0 kJ/mol\Delta G^\circ (O_2) = 0 \text{ kJ/mol}

6.26intermediate🔧 Apply3 marksShort Answer

Which of the following reactions will get affected by increasing the pressure? Also, mention whether change will cause the reaction to go into forward or backward direction. (i) COCl2(g)CO(g)+Cl2(g)COCl_2 (g) \rightleftharpoons CO (g) + Cl_2 (g) (ii) CH4(g)+2S2(g)CS2(g)+2H2S(g)CH_4 (g) + 2S_2 (g) \rightleftharpoons CS_2 (g) + 2H_2S (g) (iii) CO2(g)+C(s)2CO(g)CO_2 (g) + C (s) \rightleftharpoons 2CO (g) (iv) 2H2(g)+CO(g)CH3OH(g)2H_2 (g) + CO (g) \rightleftharpoons CH_3OH (g) (v) CaCO3(s)CaO(s)+CO2(g)CaCO_3 (s) \rightleftharpoons CaO (s) + CO_2 (g) (vi) 4NH3(g)+5O2(g)4NO(g)+6H2O(g)4NH_3 (g) + 5O_2 (g) \rightleftharpoons 4NO (g) + 6H_2O (g)

6.28intermediate🔧 Apply3 marksShort Answer

Dihydrogen gas is obtained from natural gas by partial oxidation with steam as per following endothermic reaction: CH4(g)+H2O(g)CO(g)+3H2(g)CH_4 (g) + H_2O (g) \rightleftharpoons CO (g) + 3H_2 (g) (a) Write as expression for Kp for the above reaction. (b) How will the values of Kp and composition of equilibrium mixture be affected by (i) increasing the pressure (ii) increasing the temperature (iii) using a catalyst?

6.30intermediate🔧 Apply3 marksShort Answer

At 473 K, equilibrium constant KcK_c for decomposition of phosphorus pentachloride, PCl5PCl_5 is 8.3×1038.3 \times 10^{-3}. If decomposition is depicted as, PCl5(g)PCl3(g)+Cl2(g)ΔrH=124.0 kJ mol1PCl_5(g) \rightleftharpoons PCl_3(g) + Cl_2(g) \quad \Delta_r H^\circ = 124.0 \text{ kJ mol}^{-1} a) write an expression for Kc for the reaction. b) what is the value of Kc for the reverse reaction at the same temperature? c) what would be the effect on KcK_c if (i) more PCl5_5 is added (ii) pressure is increased (iii) the temperature is increased?

6.32beginner🔍 Analyze2 marksShort Answer

Predict which of the following reaction will have appreciable concentration of reactants and products: a) Cl2(g)2Cl(g)Cl_2(g) \rightleftharpoons 2Cl(g) Kc=5×1039K_c = 5 \times 10^{-39} b) Cl2(g)+2NO(g)2NOCl(g)Cl_2(g) + 2NO(g) \rightleftharpoons 2NOCl(g) Kc=3.7×108K_c = 3.7 \times 10^8 c) Cl2(g)+2NO2(g)2NO2Cl(g)Cl_2(g) + 2NO_2(g) \rightleftharpoons 2NO_2Cl(g) Kc=1.8K_c = 1.8

6.35beginner💡 Understand2 marksShort Answer

What is meant by the conjugate acid-base pair? Find the conjugate acid/base for the following species: HNO2,CN,HClO4,F,OH,CO32,and S2HNO_2, CN^-, HClO_4, F^-, OH^-, CO_3^{2-}, \text{and S}^{2-}

6.37beginner🔧 Apply1 markShort Answer

What will be the conjugate bases for the Brönsted acids: HF, H2SO4H_2SO_4 and HCO3HCO_3^-?

6.41beginner🔧 Apply1 markNumerical

The concentration of hydrogen ion in a sample of soft drink is 3.8×1033.8 \times 10^{-3} M. What is its pH?

6.43intermediate🔧 Apply2 marksNumerical

The ionization constant of HF, HCOOH and HCN at 298K are 6.8×104,1.8×1046.8 \times 10^{-4}, 1.8 \times 10^{-4} and 4.8×1094.8 \times 10^{-9} respectively. Calculate the ionization constants of the corresponding conjugate base.

6.45advanced🔧 Apply5 marksNumerical

The first ionization constant of H2_2S is 9.1×1089.1 \times 10^{-8}. Calculate the concentration of HS^{-} ion in its 0.1 M solution. How will this concentration be affected if the solution is 0.1 M in HCl also? If the second dissociation constant of H2_2S is 1.2×10131.2 \times 10^{-13}, calculate the concentration of S2^{2-} under both conditions.

6.3intermediate🔧 Apply3 marksNumerical

At a certain temperature and total pressure of 10510^5 Pa, iodine vapour contains 40% by volume of I atoms I2(g)2I(g)I_2(g) \rightleftharpoons 2I(g) Calculate KpK_p for the equilibrium.

Page 1
Class 11 Chemistry Chapter 6: Equilibrium — NCERT Questions & Answers